C13H14N2O2S — CID 21415069
pyridin-2-ylmethyl 2-propyl-1,3-thiazole-5-carboxylate (PubChem CID 21415069) has the molecular formula C13H14N2O2S and a molecular weight of 262.33 g/mol. Its IUPAC name is pyridin-2-ylmethyl 2-propyl-1,3-thiazole-5-carboxylate.
| Compound Name | pyridin-2-ylmethyl 2-propyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 21415069 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | pyridin-2-ylmethyl 2-propyl-1,3-thiazole-5-carboxylate |
| SMILES | CCCc1ncc(C(=O)OCc2ccccn2)s1 |
| InChI | InChI=1S/C13H14N2O2S/c1-2-5-12-15-8-11(18-12)13(16)17-9-10-6-3-4-7-14-10/h3-4,6-8H,2,5,9H2,1H3 |
| InChIKey | INDNKYZEWVJYLZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |