C26H18ClNO4S — CID 141359710
ethyl 2-(2,6-dibenzoyl-4-chlorophenyl)-1,3-thiazole-5-carboxylate (PubChem CID 141359710) has the molecular formula C26H18ClNO4S and a molecular weight of 475.95 g/mol. Its IUPAC name is ethyl 2-(2,6-dibenzoyl-4-chlorophenyl)-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-(2,6-dibenzoyl-4-chlorophenyl)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 141359710 |
| Molecular Formula | C26H18ClNO4S |
| Molecular Weight | 475.95 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | ethyl 2-(2,6-dibenzoyl-4-chlorophenyl)-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(-c2c(C(=O)c3ccccc3)cc(Cl)cc2C(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C26H18ClNO4S/c1-2-32-26(31)21-15-28-25(33-21)22-19(23(29)16-9-5-3-6-10-16)13-18(27)14-20(22)24(30)17-11-7-4-8-12-17/h3-15H,2H2,1H3 |
| InChIKey | NBHARCWCKIOASN-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.95 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |