C11H13N3O2S — CID 103572384
methyl 2-(1-propylpyrazol-4-yl)-1,3-thiazole-5-carboxylate (PubChem CID 103572384) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is methyl 2-(1-propylpyrazol-4-yl)-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-(1-propylpyrazol-4-yl)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 103572384 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | methyl 2-(1-propylpyrazol-4-yl)-1,3-thiazole-5-carboxylate |
| SMILES | CCCn1cc(-c2ncc(C(=O)OC)s2)cn1 |
| InChI | InChI=1S/C11H13N3O2S/c1-3-4-14-7-8(5-13-14)10-12-6-9(17-10)11(15)16-2/h5-7H,3-4H2,1-2H3 |
| InChIKey | BBASBZLZGLXJHY-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |