C10H7ClN2S — CID 63216332
3-chloro-2-thieno[3,2-c]pyridin-4-ylpropanenitrile (PubChem CID 63216332) has the molecular formula C10H7ClN2S and a molecular weight of 222.70 g/mol. Its IUPAC name is 3-chloro-2-thieno[3,2-c]pyridin-4-ylpropanenitrile.
| Compound Name | 3-chloro-2-thieno[3,2-c]pyridin-4-ylpropanenitrile |
|---|---|
| PubChem CID | 63216332 |
| Molecular Formula | C10H7ClN2S |
| Molecular Weight | 222.70 g/mol |
| Exact Mass | 222.00 |
| IUPAC Name | 3-chloro-2-thieno[3,2-c]pyridin-4-ylpropanenitrile |
| SMILES | N#CC(CCl)c1nccc2sccc12 |
| InChI | InChI=1S/C10H7ClN2S/c11-5-7(6-12)10-8-2-4-14-9(8)1-3-13-10/h1-4,7H,5H2 |
| InChIKey | HILPJKOWJFASEN-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.70 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|