C15H14N2OS — CID 106486410
N-methyl-1-(3-thieno[3,2-c]pyridin-4-yloxyphenyl)methanamine (PubChem CID 106486410) has the molecular formula C15H14N2OS and a molecular weight of 270.36 g/mol. Its IUPAC name is N-methyl-1-(3-thieno[3,2-c]pyridin-4-yloxyphenyl)methanamine.
| Compound Name | N-methyl-1-(3-thieno[3,2-c]pyridin-4-yloxyphenyl)methanamine |
|---|---|
| PubChem CID | 106486410 |
| Molecular Formula | C15H14N2OS |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | N-methyl-1-(3-thieno[3,2-c]pyridin-4-yloxyphenyl)methanamine |
| SMILES | CNCc1cccc(Oc2nccc3sccc23)c1 |
| InChI | InChI=1S/C15H14N2OS/c1-16-10-11-3-2-4-12(9-11)18-15-13-6-8-19-14(13)5-7-17-15/h2-9,16H,10H2,1H3 |
| InChIKey | ZJUMNIBUSXWWFU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |