About 2-N-thieno[2,3-d]pyrimidin-4-ylpropane-1,2-diamine
2-N-thieno[2,3-d]pyrimidin-4-ylpropane-1,2-diamine (PubChem CID 63732565) has the molecular formula C9H12N4S
and a molecular weight of 208.29 g/mol. Its IUPAC name is 2-N-thieno[2,3-d]pyrimidin-4-ylpropane-1,2-diamine.
Molecular Properties
| Compound Name | 2-N-thieno[2,3-d]pyrimidin-4-ylpropane-1,2-diamine |
| PubChem CID | 63732565 |
| Molecular Formula | C9H12N4S |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 2-N-thieno[2,3-d]pyrimidin-4-ylpropane-1,2-diamine |
| SMILES | CC(CN)Nc1ncnc2sccc12 |
| InChI | InChI=1S/C9H12N4S/c1-6(4-10)13-8-7-2-3-14-9(7)12-5-11-8/h2-3,5-6H,4,10H2,1H3,(H,11,12,13) |
| InChIKey | BHWICDAUKJJJKO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-N-thieno[2,3-d]pyrimidin-4-ylpropane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-thieno[2,3-d]pyrimidin-4-ylpropane-1,2-diamine?
The IUPAC name of 2-N-thieno[2,3-d]pyrimidin-4-ylpropane-1,2-diamine (CID 63732565) is 2-N-thieno[2,3-d]pyrimidin-4-ylpropane-1,2-diamine.
What is the SMILES notation for 2-N-thieno[2,3-d]pyrimidin-4-ylpropane-1,2-diamine?
The canonical SMILES for 2-N-thieno[2,3-d]pyrimidin-4-ylpropane-1,2-diamine is CC(CN)Nc1ncnc2sccc12.
What is the InChIKey of 2-N-thieno[2,3-d]pyrimidin-4-ylpropane-1,2-diamine?
The InChIKey is BHWICDAUKJJJKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4S/c1-6(4-10)13-8-7-2-3-14-9(7)12-5-11-8/h2-3,5-6H,4,10H2,1H3,(H,11,12,13).
What are the key properties of 2-N-thieno[2,3-d]pyrimidin-4-ylpropane-1,2-diamine?
2-N-thieno[2,3-d]pyrimidin-4-ylpropane-1,2-diamine has a molecular weight of 208.29 g/mol, XLogP of 1.45, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-thieno[2,3-d]pyrimidin-4-ylpropane-1,2-diamine is sourced from PubChem (CID 63732565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).