C12H17N3S — CID 13038322
N-hexan-2-ylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 13038322) has the molecular formula C12H17N3S and a molecular weight of 235.36 g/mol. Its IUPAC name is N-hexan-2-ylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-hexan-2-ylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 13038322 |
| Molecular Formula | C12H17N3S |
| Molecular Weight | 235.36 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | N-hexan-2-ylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCCCC(C)Nc1ncnc2sccc12 |
| InChI | InChI=1S/C12H17N3S/c1-3-4-5-9(2)15-11-10-6-7-16-12(10)14-8-13-11/h6-9H,3-5H2,1-2H3,(H,13,14,15) |
| InChIKey | FBZWRGNTGPJVQD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |