C11H15N3OS — CID 115622916
1-(thieno[2,3-d]pyrimidin-4-ylamino)pentan-2-ol (PubChem CID 115622916) has the molecular formula C11H15N3OS and a molecular weight of 237.33 g/mol. Its IUPAC name is 1-(thieno[2,3-d]pyrimidin-4-ylamino)pentan-2-ol.
| Compound Name | 1-(thieno[2,3-d]pyrimidin-4-ylamino)pentan-2-ol |
|---|---|
| PubChem CID | 115622916 |
| Molecular Formula | C11H15N3OS |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 1-(thieno[2,3-d]pyrimidin-4-ylamino)pentan-2-ol |
| SMILES | CCCC(O)CNc1ncnc2sccc12 |
| InChI | InChI=1S/C11H15N3OS/c1-2-3-8(15)6-12-10-9-4-5-16-11(9)14-7-13-10/h4-5,7-8,15H,2-3,6H2,1H3,(H,12,13,14) |
| InChIKey | IQPHEPYGPHOVPN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |