C11H17N5O — CID 111118297
1-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]pentan-2-ol (PubChem CID 111118297) has the molecular formula C11H17N5O and a molecular weight of 235.29 g/mol. Its IUPAC name is 1-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]pentan-2-ol.
| Compound Name | 1-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]pentan-2-ol |
|---|---|
| PubChem CID | 111118297 |
| Molecular Formula | C11H17N5O |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 1-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]pentan-2-ol |
| SMILES | CCCC(O)CNc1ncnc2c1cnn2C |
| InChI | InChI=1S/C11H17N5O/c1-3-4-8(17)5-12-10-9-6-15-16(2)11(9)14-7-13-10/h6-8,17H,3-5H2,1-2H3,(H,12,13,14) |
| InChIKey | PESKJNGDZKICTF-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |