C12H19N5O — CID 103917942
6-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]hexan-1-ol (PubChem CID 103917942) has the molecular formula C12H19N5O and a molecular weight of 249.32 g/mol. Its IUPAC name is 6-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]hexan-1-ol.
| Compound Name | 6-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]hexan-1-ol |
|---|---|
| PubChem CID | 103917942 |
| Molecular Formula | C12H19N5O |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 6-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]hexan-1-ol |
| SMILES | Cn1ncc2c(NCCCCCCO)ncnc21 |
| InChI | InChI=1S/C12H19N5O/c1-17-12-10(8-16-17)11(14-9-15-12)13-6-4-2-3-5-7-18/h8-9,18H,2-7H2,1H3,(H,13,14,15) |
| InChIKey | AZGHPQIOFNMKKR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|