C13H21N5O — CID 110431867
N-(3-butoxypropyl)-1-methylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 110431867) has the molecular formula C13H21N5O and a molecular weight of 263.34 g/mol. Its IUPAC name is N-(3-butoxypropyl)-1-methylpyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | N-(3-butoxypropyl)-1-methylpyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 110431867 |
| Molecular Formula | C13H21N5O |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | N-(3-butoxypropyl)-1-methylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CCCCOCCCNc1ncnc2c1cnn2C |
| InChI | InChI=1S/C13H21N5O/c1-3-4-7-19-8-5-6-14-12-11-9-17-18(2)13(11)16-10-15-12/h9-10H,3-8H2,1-2H3,(H,14,15,16) |
| InChIKey | ZJSQOXVTAGYONO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|