C17H30N8O — CID 111240365
1-(3-butoxypropyl)-2-methyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine (PubChem CID 111240365) has the molecular formula C17H30N8O and a molecular weight of 362.48 g/mol. Its IUPAC name is 1-(3-butoxypropyl)-2-methyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine.
| Compound Name | 1-(3-butoxypropyl)-2-methyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine |
|---|---|
| PubChem CID | 111240365 |
| Molecular Formula | C17H30N8O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 1-(3-butoxypropyl)-2-methyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine |
| SMILES | CCCCOCCCN/C(=N\C)NCCNc1ncnc2c1cnn2C |
| InChI | InChI=1S/C17H30N8O/c1-4-5-10-26-11-6-7-20-17(18-2)21-9-8-19-15-14-12-24-25(3)16(14)23-13-22-15/h12-13H,4-11H2,1-3H3,(H2,18,20,21)(H,19,22,23) |
| InChIKey | UKOWYVDPGUDSFE-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 101.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|