C16H27IN8S — CID 111530246
2-methyl-1-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide (PubChem CID 111530246) has the molecular formula C16H27IN8S and a molecular weight of 490.42 g/mol. Its IUPAC name is 2-methyl-1-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111530246 |
| Molecular Formula | C16H27IN8S |
| Molecular Weight | 490.42 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | 2-methyl-1-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCNc1ncnc2c1cnn2C)NC1CCC(SC)C1.I |
| InChI | InChI=1S/C16H26N8S.HI/c1-17-16(23-11-4-5-12(8-11)25-3)19-7-6-18-14-13-9-22-24(2)15(13)21-10-20-14;/h9-12H,4-8H2,1-3H3,(H2,17,19,23)(H,18,20,21);1H |
| InChIKey | ILEHHWAPYULJOL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 92.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|