C20H34N8O — CID 109390292
1-(3-ethoxy-2,2-diethylcyclobutyl)-2-methyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine (PubChem CID 109390292) has the molecular formula C20H34N8O and a molecular weight of 402.55 g/mol. Its IUPAC name is 1-(3-ethoxy-2,2-diethylcyclobutyl)-2-methyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine.
| Compound Name | 1-(3-ethoxy-2,2-diethylcyclobutyl)-2-methyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine |
|---|---|
| PubChem CID | 109390292 |
| Molecular Formula | C20H34N8O |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.29 |
| IUPAC Name | 1-(3-ethoxy-2,2-diethylcyclobutyl)-2-methyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine |
| SMILES | CCOC1CC(N/C(=N/C)NCCNc2ncnc3c2cnn3C)C1(CC)CC |
| InChI | InChI=1S/C20H34N8O/c1-6-20(7-2)15(11-16(20)29-8-3)27-19(21-4)23-10-9-22-17-14-12-26-28(5)18(14)25-13-24-17/h12-13,15-16H,6-11H2,1-5H3,(H2,21,23,27)(H,22,24,25) |
| InChIKey | QGIJPONOTLFTMQ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 101.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|