C13H20F3IN8 — CID 109474986
2-methyl-1-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109474986) has the molecular formula C13H20F3IN8 and a molecular weight of 472.26 g/mol. Its IUPAC name is 2-methyl-1-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109474986 |
| Molecular Formula | C13H20F3IN8 |
| Molecular Weight | 472.26 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | 2-methyl-1-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCNc1ncnc2c1cnn2C)NCCC(F)(F)F.I |
| InChI | InChI=1S/C13H19F3N8.HI/c1-17-12(19-4-3-13(14,15)16)20-6-5-18-10-9-7-23-24(2)11(9)22-8-21-10;/h7-8H,3-6H2,1-2H3,(H2,17,19,20)(H,18,21,22);1H |
| InChIKey | IEEPWZRJPCSTLW-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 92.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.26 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|