C19H26N8 — CID 111938067
1-[(2,4-dimethylphenyl)methyl]-2-methyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine (PubChem CID 111938067) has the molecular formula C19H26N8 and a molecular weight of 366.47 g/mol. Its IUPAC name is 1-[(2,4-dimethylphenyl)methyl]-2-methyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine.
| Compound Name | 1-[(2,4-dimethylphenyl)methyl]-2-methyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine |
|---|---|
| PubChem CID | 111938067 |
| Molecular Formula | C19H26N8 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 1-[(2,4-dimethylphenyl)methyl]-2-methyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine |
| SMILES | C/N=C(/NCCNc1ncnc2c1cnn2C)NCc1ccc(C)cc1C |
| InChI | InChI=1S/C19H26N8/c1-13-5-6-15(14(2)9-13)10-23-19(20-3)22-8-7-21-17-16-11-26-27(4)18(16)25-12-24-17/h5-6,9,11-12H,7-8,10H2,1-4H3,(H2,20,22,23)(H,21,24,25) |
| InChIKey | OPPHVPCAFCVYGY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 92.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|