C17H24N8S — CID 111893205
1-ethyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-2-[(3-methylthiophen-2-yl)methyl]guanidine (PubChem CID 111893205) has the molecular formula C17H24N8S and a molecular weight of 372.50 g/mol. Its IUPAC name is 1-ethyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-2-[(3-methylthiophen-2-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-2-[(3-methylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111893205 |
| Molecular Formula | C17H24N8S |
| Molecular Weight | 372.50 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 1-ethyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-2-[(3-methylthiophen-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1sccc1C)NCCNc1ncnc2c1cnn2C |
| InChI | InChI=1S/C17H24N8S/c1-4-18-17(21-10-14-12(2)5-8-26-14)20-7-6-19-15-13-9-24-25(3)16(13)23-11-22-15/h5,8-9,11H,4,6-7,10H2,1-3H3,(H2,18,20,21)(H,19,22,23) |
| InChIKey | NIVNCNJSBOHWRU-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 92.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.50 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|