C21H26IN9O — CID 111551919
1-ethyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-2-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111551919) has the molecular formula C21H26IN9O and a molecular weight of 547.41 g/mol. Its IUPAC name is 1-ethyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-2-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-2-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111551919 |
| Molecular Formula | C21H26IN9O |
| Molecular Weight | 547.41 g/mol |
| Exact Mass | 547.13 |
| IUPAC Name | 1-ethyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-2-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1coc(-c2ccccc2)n1)NCCNc1ncnc2c1cnn2C.I |
| InChI | InChI=1S/C21H25N9O.HI/c1-3-22-21(25-11-16-13-31-20(29-16)15-7-5-4-6-8-15)24-10-9-23-18-17-12-28-30(2)19(17)27-14-26-18;/h4-8,12-14H,3,9-11H2,1-2H3,(H2,22,24,25)(H,23,26,27);1H |
| InChIKey | LPQNBBOMYIIPDQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 118.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|