C17H25IN8S — CID 111898362
1-ethyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-2-[(5-methylthiophen-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111898362) has the molecular formula C17H25IN8S and a molecular weight of 500.41 g/mol. Its IUPAC name is 1-ethyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-2-[(5-methylthiophen-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-2-[(5-methylthiophen-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111898362 |
| Molecular Formula | C17H25IN8S |
| Molecular Weight | 500.41 g/mol |
| Exact Mass | 500.10 |
| IUPAC Name | 1-ethyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-2-[(5-methylthiophen-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C)s1)NCCNc1ncnc2c1cnn2C.I |
| InChI | InChI=1S/C17H24N8S.HI/c1-4-18-17(21-9-13-6-5-12(2)26-13)20-8-7-19-15-14-10-24-25(3)16(14)23-11-22-15;/h5-6,10-11H,4,7-9H2,1-3H3,(H2,18,20,21)(H,19,22,23);1H |
| InChIKey | XQENFSJFLCBNBH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 92.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|