C16H22N8S — CID 111259259
1-ethyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-2-(thiophen-2-ylmethyl)guanidine (PubChem CID 111259259) has the molecular formula C16H22N8S and a molecular weight of 358.48 g/mol. Its IUPAC name is 1-ethyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-2-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 1-ethyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-2-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111259259 |
| Molecular Formula | C16H22N8S |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 1-ethyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-2-(thiophen-2-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1cccs1)NCCNc1ncnc2c1cnn2C |
| InChI | InChI=1S/C16H22N8S/c1-3-17-16(20-9-12-5-4-8-25-12)19-7-6-18-14-13-10-23-24(2)15(13)22-11-21-14/h4-5,8,10-11H,3,6-7,9H2,1-2H3,(H2,17,19,20)(H,18,21,22) |
| InChIKey | DPJVQJMGFQGBPL-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 92.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|