C24H36IN9 — CID 111411670
1-ethyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-2-[[4-(piperidin-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111411670) has the molecular formula C24H36IN9 and a molecular weight of 577.52 g/mol. Its IUPAC name is 1-ethyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-2-[[4-(piperidin-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-2-[[4-(piperidin-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111411670 |
| Molecular Formula | C24H36IN9 |
| Molecular Weight | 577.52 g/mol |
| Exact Mass | 577.21 |
| IUPAC Name | 1-ethyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-2-[[4-(piperidin-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(CN2CCCCC2)cc1)NCCNc1ncnc2c1cnn2C.I |
| InChI | InChI=1S/C24H35N9.HI/c1-3-25-24(27-12-11-26-22-21-16-31-32(2)23(21)30-18-29-22)28-15-19-7-9-20(10-8-19)17-33-13-5-4-6-14-33;/h7-10,16,18H,3-6,11-15,17H2,1-2H3,(H2,25,27,28)(H,26,29,30);1H |
| InChIKey | SABKWPJSWBSMCW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 95.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|