C20H35N9 — CID 111325154
2-[3-(azepan-1-yl)propyl]-1-ethyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine (PubChem CID 111325154) has the molecular formula C20H35N9 and a molecular weight of 401.56 g/mol. Its IUPAC name is 2-[3-(azepan-1-yl)propyl]-1-ethyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine.
| Compound Name | 2-[3-(azepan-1-yl)propyl]-1-ethyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine |
|---|---|
| PubChem CID | 111325154 |
| Molecular Formula | C20H35N9 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.30 |
| IUPAC Name | 2-[3-(azepan-1-yl)propyl]-1-ethyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine |
| SMILES | CCN/C(=N\CCCN1CCCCCC1)NCCNc1ncnc2c1cnn2C |
| InChI | InChI=1S/C20H35N9/c1-3-21-20(23-9-8-14-29-12-6-4-5-7-13-29)24-11-10-22-18-17-15-27-28(2)19(17)26-16-25-18/h15-16H,3-14H2,1-2H3,(H2,21,23,24)(H,22,25,26) |
| InChIKey | RFWKJWXINDTKFY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 95.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|