C18H32N8 — CID 111204086
1-ethyl-3-(5-methylhexan-2-yl)-2-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine (PubChem CID 111204086) has the molecular formula C18H32N8 and a molecular weight of 360.51 g/mol. Its IUPAC name is 1-ethyl-3-(5-methylhexan-2-yl)-2-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine.
| Compound Name | 1-ethyl-3-(5-methylhexan-2-yl)-2-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine |
|---|---|
| PubChem CID | 111204086 |
| Molecular Formula | C18H32N8 |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | 1-ethyl-3-(5-methylhexan-2-yl)-2-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine |
| SMILES | CCN/C(=N\CCNc1ncnc2c1cnn2C)NC(C)CCC(C)C |
| InChI | InChI=1S/C18H32N8/c1-6-19-18(25-14(4)8-7-13(2)3)21-10-9-20-16-15-11-24-26(5)17(15)23-12-22-16/h11-14H,6-10H2,1-5H3,(H2,19,21,25)(H,20,22,23) |
| InChIKey | RWAMNWQVUUTOSI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 92.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|