C12H21IN8 — CID 111101792
1-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-2-propylguanidine;hydroiodide (PubChem CID 111101792) has the molecular formula C12H21IN8 and a molecular weight of 404.26 g/mol. Its IUPAC name is 1-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-2-propylguanidine;hydroiodide.
| Compound Name | 1-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-2-propylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111101792 |
| Molecular Formula | C12H21IN8 |
| Molecular Weight | 404.26 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 1-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]-2-propylguanidine;hydroiodide |
| SMILES | CCC/N=C(\N)NCCNc1ncnc2c1cnn2C.I |
| InChI | InChI=1S/C12H20N8.HI/c1-3-4-15-12(13)16-6-5-14-10-9-7-19-20(2)11(9)18-8-17-10;/h7-8H,3-6H2,1-2H3,(H3,13,15,16)(H,14,17,18);1H |
| InChIKey | KHMUYJHXWJYJAF-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 106.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.26 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|