C19H27IN8 — CID 110951751
1-benzyl-3-ethyl-1-methyl-2-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine;hydroiodide (PubChem CID 110951751) has the molecular formula C19H27IN8 and a molecular weight of 494.39 g/mol. Its IUPAC name is 1-benzyl-3-ethyl-1-methyl-2-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-benzyl-3-ethyl-1-methyl-2-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110951751 |
| Molecular Formula | C19H27IN8 |
| Molecular Weight | 494.39 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | 1-benzyl-3-ethyl-1-methyl-2-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCNc1ncnc2c1cnn2C)N(C)Cc1ccccc1.I |
| InChI | InChI=1S/C19H26N8.HI/c1-4-20-19(26(2)13-15-8-6-5-7-9-15)22-11-10-21-17-16-12-25-27(3)18(16)24-14-23-17;/h5-9,12,14H,4,10-11,13H2,1-3H3,(H,20,22)(H,21,23,24);1H |
| InChIKey | FZVQTDQFIVPHAE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 83.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|