C19H25BrN8 — CID 111276137
1-[(2-bromophenyl)methyl]-3-ethyl-1-methyl-2-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine (PubChem CID 111276137) has the molecular formula C19H25BrN8 and a molecular weight of 445.37 g/mol. Its IUPAC name is 1-[(2-bromophenyl)methyl]-3-ethyl-1-methyl-2-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine.
| Compound Name | 1-[(2-bromophenyl)methyl]-3-ethyl-1-methyl-2-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine |
|---|---|
| PubChem CID | 111276137 |
| Molecular Formula | C19H25BrN8 |
| Molecular Weight | 445.37 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 1-[(2-bromophenyl)methyl]-3-ethyl-1-methyl-2-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine |
| SMILES | CCN/C(=N\CCNc1ncnc2c1cnn2C)N(C)Cc1ccccc1Br |
| InChI | InChI=1S/C19H25BrN8/c1-4-21-19(27(2)12-14-7-5-6-8-16(14)20)23-10-9-22-17-15-11-26-28(3)18(15)25-13-24-17/h5-8,11,13H,4,9-10,12H2,1-3H3,(H,21,23)(H,22,24,25) |
| InChIKey | VOFSRNBGSHNDKZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 83.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|