C18H24BrIN8 — CID 111293270
1-[(4-bromophenyl)methyl]-1,2-dimethyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine;hydroiodide (PubChem CID 111293270) has the molecular formula C18H24BrIN8 and a molecular weight of 559.25 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-1,2-dimethyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-[(4-bromophenyl)methyl]-1,2-dimethyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111293270 |
| Molecular Formula | C18H24BrIN8 |
| Molecular Weight | 559.25 g/mol |
| Exact Mass | 558.04 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-1,2-dimethyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCNc1ncnc2c1cnn2C)N(C)Cc1ccc(Br)cc1.I |
| InChI | InChI=1S/C18H23BrN8.HI/c1-20-18(26(2)11-13-4-6-14(19)7-5-13)22-9-8-21-16-15-10-25-27(3)17(15)24-12-23-16;/h4-7,10,12H,8-9,11H2,1-3H3,(H,20,22)(H,21,23,24);1H |
| InChIKey | QUQDBSBUBZNPCQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 83.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.25 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|