C19H26FIN8 — CID 111307493
3-ethyl-1-[(4-fluorophenyl)methyl]-1-methyl-2-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine;hydroiodide (PubChem CID 111307493) has the molecular formula C19H26FIN8 and a molecular weight of 512.38 g/mol. Its IUPAC name is 3-ethyl-1-[(4-fluorophenyl)methyl]-1-methyl-2-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-[(4-fluorophenyl)methyl]-1-methyl-2-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111307493 |
| Molecular Formula | C19H26FIN8 |
| Molecular Weight | 512.38 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | 3-ethyl-1-[(4-fluorophenyl)methyl]-1-methyl-2-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCNc1ncnc2c1cnn2C)N(C)Cc1ccc(F)cc1.I |
| InChI | InChI=1S/C19H25FN8.HI/c1-4-21-19(27(2)12-14-5-7-15(20)8-6-14)23-10-9-22-17-16-11-26-28(3)18(16)25-13-24-17;/h5-8,11,13H,4,9-10,12H2,1-3H3,(H,21,23)(H,22,24,25);1H |
| InChIKey | SEHXCMGONHPTTM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 83.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|