C19H27IN8O — CID 111171522
1-[2-(4-methoxyphenyl)ethyl]-2-methyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine;hydroiodide (PubChem CID 111171522) has the molecular formula C19H27IN8O and a molecular weight of 510.38 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenyl)ethyl]-2-methyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(4-methoxyphenyl)ethyl]-2-methyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111171522 |
| Molecular Formula | C19H27IN8O |
| Molecular Weight | 510.38 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | 1-[2-(4-methoxyphenyl)ethyl]-2-methyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCNc1ncnc2c1cnn2C)NCCc1ccc(OC)cc1.I |
| InChI | InChI=1S/C19H26N8O.HI/c1-20-19(22-9-8-14-4-6-15(28-3)7-5-14)23-11-10-21-17-16-12-26-27(2)18(16)25-13-24-17;/h4-7,12-13H,8-11H2,1-3H3,(H2,20,22,23)(H,21,24,25);1H |
| InChIKey | GYBKZIMYEISXPD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 101.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|