C20H25FIN9 — CID 111888316
1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine;hydroiodide (PubChem CID 111888316) has the molecular formula C20H25FIN9 and a molecular weight of 537.39 g/mol. Its IUPAC name is 1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111888316 |
| Molecular Formula | C20H25FIN9 |
| Molecular Weight | 537.39 g/mol |
| Exact Mass | 537.13 |
| IUPAC Name | 1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCNc1ncnc2c1cnn2C)NCCc1c[nH]c2cc(F)ccc12.I |
| InChI | InChI=1S/C20H24FN9.HI/c1-22-20(24-6-5-13-10-26-17-9-14(21)3-4-15(13)17)25-8-7-23-18-16-11-29-30(2)19(16)28-12-27-18;/h3-4,9-12,26H,5-8H2,1-2H3,(H2,22,24,25)(H,23,27,28);1H |
| InChIKey | ZLKXPMWDVFUMCS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 107.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|