C20H28FIN6 — CID 111887912
1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 111887912) has the molecular formula C20H28FIN6 and a molecular weight of 498.39 g/mol. Its IUPAC name is 1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111887912 |
| Molecular Formula | C20H28FIN6 |
| Molecular Weight | 498.39 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | 1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1c(C)nn(C)c1C)NCCc1c[nH]c2cc(F)ccc12.I |
| InChI | InChI=1S/C20H27FN6.HI/c1-13-17(14(2)27(4)26-13)8-10-24-20(22-3)23-9-7-15-12-25-19-11-16(21)5-6-18(15)19;/h5-6,11-12,25H,7-10H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | NJQCSTPVQVXHIQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 70.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|