C16H29IN8 — CID 111942996
2-methyl-1-(4-methylpentyl)-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine;hydroiodide (PubChem CID 111942996) has the molecular formula C16H29IN8 and a molecular weight of 460.37 g/mol. Its IUPAC name is 2-methyl-1-(4-methylpentyl)-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(4-methylpentyl)-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111942996 |
| Molecular Formula | C16H29IN8 |
| Molecular Weight | 460.37 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 2-methyl-1-(4-methylpentyl)-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCC(C)C)NCCNc1ncnc2c1cnn2C.I |
| InChI | InChI=1S/C16H28N8.HI/c1-12(2)6-5-7-19-16(17-3)20-9-8-18-14-13-10-23-24(4)15(13)22-11-21-14;/h10-12H,5-9H2,1-4H3,(H2,17,19,20)(H,18,21,22);1H |
| InChIKey | XSCMSHCCJVGFFW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 92.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|