C21H31IN8O — CID 111687193
1-ethyl-2-[2-(2-methylphenoxy)propyl]-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine;hydroiodide (PubChem CID 111687193) has the molecular formula C21H31IN8O and a molecular weight of 538.44 g/mol. Its IUPAC name is 1-ethyl-2-[2-(2-methylphenoxy)propyl]-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(2-methylphenoxy)propyl]-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111687193 |
| Molecular Formula | C21H31IN8O |
| Molecular Weight | 538.44 g/mol |
| Exact Mass | 538.17 |
| IUPAC Name | 1-ethyl-2-[2-(2-methylphenoxy)propyl]-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)Oc1ccccc1C)NCCNc1ncnc2c1cnn2C.I |
| InChI | InChI=1S/C21H30N8O.HI/c1-5-22-21(25-12-16(3)30-18-9-7-6-8-15(18)2)24-11-10-23-19-17-13-28-29(4)20(17)27-14-26-19;/h6-9,13-14,16H,5,10-12H2,1-4H3,(H2,22,24,25)(H,23,26,27);1H |
| InChIKey | IPVHPJHLOCOUSX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 101.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|