C18H24ClIN8 — CID 111174337
2-[(2-chlorophenyl)methyl]-1-ethyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine;hydroiodide (PubChem CID 111174337) has the molecular formula C18H24ClIN8 and a molecular weight of 514.80 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl]-1-ethyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine;hydroiodide.
| Compound Name | 2-[(2-chlorophenyl)methyl]-1-ethyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111174337 |
| Molecular Formula | C18H24ClIN8 |
| Molecular Weight | 514.80 g/mol |
| Exact Mass | 514.09 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl]-1-ethyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1Cl)NCCNc1ncnc2c1cnn2C.I |
| InChI | InChI=1S/C18H23ClN8.HI/c1-3-20-18(23-10-13-6-4-5-7-15(13)19)22-9-8-21-16-14-11-26-27(2)17(14)25-12-24-16;/h4-7,11-12H,3,8-10H2,1-2H3,(H2,20,22,23)(H,21,24,25);1H |
| InChIKey | ZEULXCRAOPQBCX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 92.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.80 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|