C19H30N8 — CID 111209194
2-[2-(cyclohexen-1-yl)ethyl]-1-ethyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine (PubChem CID 111209194) has the molecular formula C19H30N8 and a molecular weight of 370.51 g/mol. Its IUPAC name is 2-[2-(cyclohexen-1-yl)ethyl]-1-ethyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine.
| Compound Name | 2-[2-(cyclohexen-1-yl)ethyl]-1-ethyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine |
|---|---|
| PubChem CID | 111209194 |
| Molecular Formula | C19H30N8 |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | 2-[2-(cyclohexen-1-yl)ethyl]-1-ethyl-3-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine |
| SMILES | CCN/C(=N\CCC1=CCCCC1)NCCNc1ncnc2c1cnn2C |
| InChI | InChI=1S/C19H30N8/c1-3-20-19(22-10-9-15-7-5-4-6-8-15)23-12-11-21-17-16-13-26-27(2)18(16)25-14-24-17/h7,13-14H,3-6,8-12H2,1-2H3,(H2,20,22,23)(H,21,24,25) |
| InChIKey | DGADQHRHDMKMGX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 92.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|