C21H29N9O — CID 111633175
3-[2-[[ethylamino-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethylamino]methylidene]amino]ethyl]-N-methylbenzamide (PubChem CID 111633175) has the molecular formula C21H29N9O and a molecular weight of 423.53 g/mol. Its IUPAC name is 3-[2-[[ethylamino-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethylamino]methylidene]amino]ethyl]-N-methylbenzamide.
| Compound Name | 3-[2-[[ethylamino-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethylamino]methylidene]amino]ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 111633175 |
| Molecular Formula | C21H29N9O |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | 3-[2-[[ethylamino-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethylamino]methylidene]amino]ethyl]-N-methylbenzamide |
| SMILES | CCN/C(=N\CCc1cccc(C(=O)NC)c1)NCCNc1ncnc2c1cnn2C |
| InChI | InChI=1S/C21H29N9O/c1-4-23-21(25-9-8-15-6-5-7-16(12-15)20(31)22-2)26-11-10-24-18-17-13-29-30(3)19(17)28-14-27-18/h5-7,12-14H,4,8-11H2,1-3H3,(H,22,31)(H2,23,25,26)(H,24,27,28) |
| InChIKey | WQQVKXDQCKLTDB-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 121.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|