C13H22N8 — CID 111101803
1-tert-butyl-2-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine (PubChem CID 111101803) has the molecular formula C13H22N8 and a molecular weight of 290.38 g/mol. Its IUPAC name is 1-tert-butyl-2-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine.
| Compound Name | 1-tert-butyl-2-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine |
|---|---|
| PubChem CID | 111101803 |
| Molecular Formula | C13H22N8 |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 1-tert-butyl-2-[2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]ethyl]guanidine |
| SMILES | Cn1ncc2c(NCC/N=C(\N)NC(C)(C)C)ncnc21 |
| InChI | InChI=1S/C13H22N8/c1-13(2,3)20-12(14)16-6-5-15-10-9-7-19-21(4)11(9)18-8-17-10/h7-8H,5-6H2,1-4H3,(H3,14,16,20)(H,15,17,18) |
| InChIKey | JQKYGCVRPNMRGO-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 106.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|