C15H24N6 — CID 115306725
N-cycloheptyl-N'-(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)ethane-1,2-diamine (PubChem CID 115306725) has the molecular formula C15H24N6 and a molecular weight of 288.40 g/mol. Its IUPAC name is N-cycloheptyl-N'-(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)ethane-1,2-diamine.
| Compound Name | N-cycloheptyl-N'-(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 115306725 |
| Molecular Formula | C15H24N6 |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | N-cycloheptyl-N'-(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)ethane-1,2-diamine |
| SMILES | Cn1ncc2c(NCCNC3CCCCCC3)ncnc21 |
| InChI | InChI=1S/C15H24N6/c1-21-15-13(10-20-21)14(18-11-19-15)17-9-8-16-12-6-4-2-3-5-7-12/h10-12,16H,2-9H2,1H3,(H,17,18,19) |
| InChIKey | LHBXSGXEZJMQEM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|