C13H18N4S — CID 113222136
N-(2-pyrrolidin-1-ylpropyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 113222136) has the molecular formula C13H18N4S and a molecular weight of 262.38 g/mol. Its IUPAC name is N-(2-pyrrolidin-1-ylpropyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(2-pyrrolidin-1-ylpropyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 113222136 |
| Molecular Formula | C13H18N4S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N-(2-pyrrolidin-1-ylpropyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CC(CNc1ncnc2sccc12)N1CCCC1 |
| InChI | InChI=1S/C13H18N4S/c1-10(17-5-2-3-6-17)8-14-12-11-4-7-18-13(11)16-9-15-12/h4,7,9-10H,2-3,5-6,8H2,1H3,(H,14,15,16) |
| InChIKey | XZTPWVRDZVGSSC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |