About N-[5-(4-chlorophenyl)pent-4-yn-2-yl]thieno[2,3-d]pyrimidin-4-amine
N-[5-(4-chlorophenyl)pent-4-yn-2-yl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 67890240) has the molecular formula C17H14ClN3S
and a molecular weight of 327.84 g/mol. Its IUPAC name is N-[5-(4-chlorophenyl)pent-4-yn-2-yl]thieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-[5-(4-chlorophenyl)pent-4-yn-2-yl]thieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 67890240 |
| Molecular Formula | C17H14ClN3S |
| Molecular Weight | 327.84 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | N-[5-(4-chlorophenyl)pent-4-yn-2-yl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CC(CC#Cc1ccc(Cl)cc1)Nc1ncnc2sccc12 |
| InChI | InChI=1S/C17H14ClN3S/c1-12(3-2-4-13-5-7-14(18)8-6-13)21-16-15-9-10-22-17(15)20-11-19-16/h5-12H,3H2,1H3,(H,19,20,21) |
| InChIKey | NKWDXWKOKHUJMU-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.84 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[5-(4-chlorophenyl)pent-4-yn-2-yl]thieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(4-chlorophenyl)pent-4-yn-2-yl]thieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of N-[5-(4-chlorophenyl)pent-4-yn-2-yl]thieno[2,3-d]pyrimidin-4-amine (CID 67890240) is N-[5-(4-chlorophenyl)pent-4-yn-2-yl]thieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for N-[5-(4-chlorophenyl)pent-4-yn-2-yl]thieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for N-[5-(4-chlorophenyl)pent-4-yn-2-yl]thieno[2,3-d]pyrimidin-4-amine is CC(CC#Cc1ccc(Cl)cc1)Nc1ncnc2sccc12.
What is the InChIKey of N-[5-(4-chlorophenyl)pent-4-yn-2-yl]thieno[2,3-d]pyrimidin-4-amine?
The InChIKey is NKWDXWKOKHUJMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14ClN3S/c1-12(3-2-4-13-5-7-14(18)8-6-13)21-16-15-9-10-22-17(15)20-11-19-16/h5-12H,3H2,1H3,(H,19,20,21).
What are the key properties of N-[5-(4-chlorophenyl)pent-4-yn-2-yl]thieno[2,3-d]pyrimidin-4-amine?
N-[5-(4-chlorophenyl)pent-4-yn-2-yl]thieno[2,3-d]pyrimidin-4-amine has a molecular weight of 327.84 g/mol, XLogP of 4.59, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(4-chlorophenyl)pent-4-yn-2-yl]thieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 67890240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).