C17H14ClN3S — CID 67890240
N-[5-(4-chlorophenyl)pent-4-yn-2-yl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 67890240) has the molecular formula C17H14ClN3S and a molecular weight of 327.84 g/mol. Its IUPAC name is N-[5-(4-chlorophenyl)pent-4-yn-2-yl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[5-(4-chlorophenyl)pent-4-yn-2-yl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 67890240 |
| Molecular Formula | C17H14ClN3S |
| Molecular Weight | 327.84 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | N-[5-(4-chlorophenyl)pent-4-yn-2-yl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CC(CC#Cc1ccc(Cl)cc1)Nc1ncnc2sccc12 |
| InChI | InChI=1S/C17H14ClN3S/c1-12(3-2-4-13-5-7-14(18)8-6-13)21-16-15-9-10-22-17(15)20-11-19-16/h5-12H,3H2,1H3,(H,19,20,21) |
| InChIKey | NKWDXWKOKHUJMU-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.84 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|