C18H20N2OS — CID 71341854
4-[2-(4-tert-butylphenyl)ethoxy]thieno[2,3-d]pyrimidine (PubChem CID 71341854) has the molecular formula C18H20N2OS and a molecular weight of 312.44 g/mol. Its IUPAC name is 4-[2-(4-tert-butylphenyl)ethoxy]thieno[2,3-d]pyrimidine.
| Compound Name | 4-[2-(4-tert-butylphenyl)ethoxy]thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 71341854 |
| Molecular Formula | C18H20N2OS |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 4-[2-(4-tert-butylphenyl)ethoxy]thieno[2,3-d]pyrimidine |
| SMILES | CC(C)(C)c1ccc(CCOc2ncnc3sccc23)cc1 |
| InChI | InChI=1S/C18H20N2OS/c1-18(2,3)14-6-4-13(5-7-14)8-10-21-16-15-9-11-22-17(15)20-12-19-16/h4-7,9,11-12H,8,10H2,1-3H3 |
| InChIKey | CJJQVTANUOIVHE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |