C15H10Cl2N2O3S — CID 4830116
ethyl 3,5-dichloro-4-thieno[2,3-d]pyrimidin-4-yloxybenzoate (PubChem CID 4830116) has the molecular formula C15H10Cl2N2O3S and a molecular weight of 369.23 g/mol. Its IUPAC name is ethyl 3,5-dichloro-4-thieno[2,3-d]pyrimidin-4-yloxybenzoate.
| Compound Name | ethyl 3,5-dichloro-4-thieno[2,3-d]pyrimidin-4-yloxybenzoate |
|---|---|
| PubChem CID | 4830116 |
| Molecular Formula | C15H10Cl2N2O3S |
| Molecular Weight | 369.23 g/mol |
| Exact Mass | 367.98 |
| IUPAC Name | ethyl 3,5-dichloro-4-thieno[2,3-d]pyrimidin-4-yloxybenzoate |
| SMILES | CCOC(=O)c1cc(Cl)c(Oc2ncnc3sccc23)c(Cl)c1 |
| InChI | InChI=1S/C15H10Cl2N2O3S/c1-2-21-15(20)8-5-10(16)12(11(17)6-8)22-13-9-3-4-23-14(9)19-7-18-13/h3-7H,2H2,1H3 |
| InChIKey | VDOJJPLLHGVYON-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.23 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |