C16H10N2O2S — CID 60871060
3-thieno[2,3-d]pyrimidin-4-yloxynaphthalen-2-ol (PubChem CID 60871060) has the molecular formula C16H10N2O2S and a molecular weight of 294.34 g/mol. Its IUPAC name is 3-thieno[2,3-d]pyrimidin-4-yloxynaphthalen-2-ol.
| Compound Name | 3-thieno[2,3-d]pyrimidin-4-yloxynaphthalen-2-ol |
|---|---|
| PubChem CID | 60871060 |
| Molecular Formula | C16H10N2O2S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 3-thieno[2,3-d]pyrimidin-4-yloxynaphthalen-2-ol |
| SMILES | Oc1cc2ccccc2cc1Oc1ncnc2sccc12 |
| InChI | InChI=1S/C16H10N2O2S/c19-13-7-10-3-1-2-4-11(10)8-14(13)20-15-12-5-6-21-16(12)18-9-17-15/h1-9,19H |
| InChIKey | ZBVRNJZMJMQIGV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |