C9H8ClN3O — CID 83884740
5-(2-chlorophenyl)-N-methyl-1,3,4-oxadiazol-2-amine (PubChem CID 83884740) has the molecular formula C9H8ClN3O and a molecular weight of 209.64 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-N-methyl-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(2-chlorophenyl)-N-methyl-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 83884740 |
| Molecular Formula | C9H8ClN3O |
| Molecular Weight | 209.64 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | 5-(2-chlorophenyl)-N-methyl-1,3,4-oxadiazol-2-amine |
| SMILES | CNc1nnc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C9H8ClN3O/c1-11-9-13-12-8(14-9)6-4-2-3-5-7(6)10/h2-5H,1H3,(H,11,13) |
| InChIKey | VYMRHVDNJPQIND-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.64 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |