C7H11IN2O — CID 114771691
2-iodo-5-(3-methylbutan-2-yl)-1,3,4-oxadiazole (PubChem CID 114771691) has the molecular formula C7H11IN2O and a molecular weight of 266.08 g/mol. Its IUPAC name is 2-iodo-5-(3-methylbutan-2-yl)-1,3,4-oxadiazole.
| Compound Name | 2-iodo-5-(3-methylbutan-2-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 114771691 |
| Molecular Formula | C7H11IN2O |
| Molecular Weight | 266.08 g/mol |
| Exact Mass | 265.99 |
| IUPAC Name | 2-iodo-5-(3-methylbutan-2-yl)-1,3,4-oxadiazole |
| SMILES | CC(C)C(C)c1nnc(I)o1 |
| InChI | InChI=1S/C7H11IN2O/c1-4(2)5(3)6-9-10-7(8)11-6/h4-5H,1-3H3 |
| InChIKey | SGYCNZFNUOZIBS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.08 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|