C5HF6IN2O — CID 103311357
2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-5-iodo-1,3,4-oxadiazole (PubChem CID 103311357) has the molecular formula C5HF6IN2O and a molecular weight of 345.97 g/mol. Its IUPAC name is 2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-5-iodo-1,3,4-oxadiazole.
| Compound Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-5-iodo-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 103311357 |
| Molecular Formula | C5HF6IN2O |
| Molecular Weight | 345.97 g/mol |
| Exact Mass | 345.90 |
| IUPAC Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yl)-5-iodo-1,3,4-oxadiazole |
| SMILES | FC(F)(F)C(c1nnc(I)o1)C(F)(F)F |
| InChI | InChI=1S/C5HF6IN2O/c6-4(7,8)1(5(9,10)11)2-13-14-3(12)15-2/h1H |
| InChIKey | GNNRGGIQOJEIKN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.97 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|