C10H13F6N3O — CID 103310854
1-[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,2,4-oxadiazol-3-yl]-2,2-dimethylpropan-1-amine (PubChem CID 103310854) has the molecular formula C10H13F6N3O and a molecular weight of 305.22 g/mol. Its IUPAC name is 1-[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,2,4-oxadiazol-3-yl]-2,2-dimethylpropan-1-amine.
| Compound Name | 1-[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,2,4-oxadiazol-3-yl]-2,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 103310854 |
| Molecular Formula | C10H13F6N3O |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 1-[5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,2,4-oxadiazol-3-yl]-2,2-dimethylpropan-1-amine |
| SMILES | CC(C)(C)C(N)c1noc(C(C(F)(F)F)C(F)(F)F)n1 |
| InChI | InChI=1S/C10H13F6N3O/c1-8(2,3)5(17)6-18-7(20-19-6)4(9(11,12)13)10(14,15)16/h4-5H,17H2,1-3H3 |
| InChIKey | UPFLKPHLRAGKSI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |