C12H19N5O2 — CID 120974105
1-[[(2R,5S)-5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)oxolan-2-yl]methyl]-2-methylguanidine (PubChem CID 120974105) has the molecular formula C12H19N5O2 and a molecular weight of 265.32 g/mol. Its IUPAC name is 1-[[(2R,5S)-5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)oxolan-2-yl]methyl]-2-methylguanidine.
| Compound Name | 1-[[(2R,5S)-5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)oxolan-2-yl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 120974105 |
| Molecular Formula | C12H19N5O2 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 1-[[(2R,5S)-5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)oxolan-2-yl]methyl]-2-methylguanidine |
| SMILES | C/N=C(\N)NC[C@H]1CC[C@@H](c2nc(C3CC3)no2)O1 |
| InChI | InChI=1S/C12H19N5O2/c1-14-12(13)15-6-8-4-5-9(18-8)11-16-10(17-19-11)7-2-3-7/h7-9H,2-6H2,1H3,(H3,13,14,15)/t8-,9+/m1/s1 |
| InChIKey | PQEKBEUCAUJRCG-BDAKNGLRSA-N |
| XLogP | 0.70 |
| TPSA | 98.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|