C17H22IN5O2 — CID 120974082
2-[[(2R,5S)-5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)oxolan-2-yl]methyl]-1-phenylguanidine;hydroiodide (PubChem CID 120974082) has the molecular formula C17H22IN5O2 and a molecular weight of 455.30 g/mol. Its IUPAC name is 2-[[(2R,5S)-5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)oxolan-2-yl]methyl]-1-phenylguanidine;hydroiodide.
| Compound Name | 2-[[(2R,5S)-5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)oxolan-2-yl]methyl]-1-phenylguanidine;hydroiodide |
|---|---|
| PubChem CID | 120974082 |
| Molecular Formula | C17H22IN5O2 |
| Molecular Weight | 455.30 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | 2-[[(2R,5S)-5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)oxolan-2-yl]methyl]-1-phenylguanidine;hydroiodide |
| SMILES | I.N/C(=N\C[C@H]1CC[C@@H](c2nc(C3CC3)no2)O1)Nc1ccccc1 |
| InChI | InChI=1S/C17H21N5O2.HI/c18-17(20-12-4-2-1-3-5-12)19-10-13-8-9-14(23-13)16-21-15(22-24-16)11-6-7-11;/h1-5,11,13-14H,6-10H2,(H3,18,19,20);1H/t13-,14+;/m1./s1 |
| InChIKey | KWSCNUNHKUWNCY-DFQHDRSWSA-N |
| XLogP | 3.21 |
| TPSA | 98.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|