C17H27N5O2 — CID 120974109
N'-[[(2R,5S)-5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)oxolan-2-yl]methyl]-3-methylpiperidine-1-carboximidamide (PubChem CID 120974109) has the molecular formula C17H27N5O2 and a molecular weight of 333.44 g/mol. Its IUPAC name is N'-[[(2R,5S)-5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)oxolan-2-yl]methyl]-3-methylpiperidine-1-carboximidamide.
| Compound Name | N'-[[(2R,5S)-5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)oxolan-2-yl]methyl]-3-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 120974109 |
| Molecular Formula | C17H27N5O2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | N'-[[(2R,5S)-5-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)oxolan-2-yl]methyl]-3-methylpiperidine-1-carboximidamide |
| SMILES | CC1CCCN(/C(N)=N/C[C@H]2CC[C@@H](c3nc(C4CC4)no3)O2)C1 |
| InChI | InChI=1S/C17H27N5O2/c1-11-3-2-8-22(10-11)17(18)19-9-13-6-7-14(23-13)16-20-15(21-24-16)12-4-5-12/h11-14H,2-10H2,1H3,(H2,18,19)/t11?,13-,14+/m1/s1 |
| InChIKey | AMFBILAVGBOWSG-WLPIGLKUSA-N |
| XLogP | 2.21 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|